C15H31N3O2 — CID 63252237
N-(2-aminoethyl)-1-(4-methoxy-4-methylpentan-2-yl)piperidine-3-carboxamide (PubChem CID 63252237) has the molecular formula C15H31N3O2 and a molecular weight of 285.43 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-(4-methoxy-4-methylpentan-2-yl)piperidine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-(4-methoxy-4-methylpentan-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 63252237 |
| Molecular Formula | C15H31N3O2 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.24 |
| IUPAC Name | N-(2-aminoethyl)-1-(4-methoxy-4-methylpentan-2-yl)piperidine-3-carboxamide |
| SMILES | COC(C)(C)CC(C)N1CCCC(C(=O)NCCN)C1 |
| InChI | InChI=1S/C15H31N3O2/c1-12(10-15(2,3)20-4)18-9-5-6-13(11-18)14(19)17-8-7-16/h12-13H,5-11,16H2,1-4H3,(H,17,19) |
| InChIKey | JMWQCLOPJQNOQG-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |