About 1-N-(4-methoxypyrimidin-2-yl)cyclopentane-1,2-diamine
1-N-(4-methoxypyrimidin-2-yl)cyclopentane-1,2-diamine (PubChem CID 63252268) has the molecular formula C10H16N4O
and a molecular weight of 208.26 g/mol. Its IUPAC name is 1-N-(4-methoxypyrimidin-2-yl)cyclopentane-1,2-diamine.
Molecular Properties
| Compound Name | 1-N-(4-methoxypyrimidin-2-yl)cyclopentane-1,2-diamine |
| PubChem CID | 63252268 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 1-N-(4-methoxypyrimidin-2-yl)cyclopentane-1,2-diamine |
| SMILES | COc1ccnc(NC2CCCC2N)n1 |
| InChI | InChI=1S/C10H16N4O/c1-15-9-5-6-12-10(14-9)13-8-4-2-3-7(8)11/h5-8H,2-4,11H2,1H3,(H,12,13,14) |
| InChIKey | YWTSJIWWAGXNJO-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-N-(4-methoxypyrimidin-2-yl)cyclopentane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-(4-methoxypyrimidin-2-yl)cyclopentane-1,2-diamine?
The IUPAC name of 1-N-(4-methoxypyrimidin-2-yl)cyclopentane-1,2-diamine (CID 63252268) is 1-N-(4-methoxypyrimidin-2-yl)cyclopentane-1,2-diamine.
What is the SMILES notation for 1-N-(4-methoxypyrimidin-2-yl)cyclopentane-1,2-diamine?
The canonical SMILES for 1-N-(4-methoxypyrimidin-2-yl)cyclopentane-1,2-diamine is COc1ccnc(NC2CCCC2N)n1.
What is the InChIKey of 1-N-(4-methoxypyrimidin-2-yl)cyclopentane-1,2-diamine?
The InChIKey is YWTSJIWWAGXNJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4O/c1-15-9-5-6-12-10(14-9)13-8-4-2-3-7(8)11/h5-8H,2-4,11H2,1H3,(H,12,13,14).
What are the key properties of 1-N-(4-methoxypyrimidin-2-yl)cyclopentane-1,2-diamine?
1-N-(4-methoxypyrimidin-2-yl)cyclopentane-1,2-diamine has a molecular weight of 208.26 g/mol, XLogP of 0.78, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-(4-methoxypyrimidin-2-yl)cyclopentane-1,2-diamine is sourced from PubChem (CID 63252268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).