C16H32N4O — CID 63252510
N-(2-aminoethyl)-1-(1-propylpiperidin-4-yl)piperidine-3-carboxamide (PubChem CID 63252510) has the molecular formula C16H32N4O and a molecular weight of 296.46 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-(1-propylpiperidin-4-yl)piperidine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-(1-propylpiperidin-4-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 63252510 |
| Molecular Formula | C16H32N4O |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.26 |
| IUPAC Name | N-(2-aminoethyl)-1-(1-propylpiperidin-4-yl)piperidine-3-carboxamide |
| SMILES | CCCN1CCC(N2CCCC(C(=O)NCCN)C2)CC1 |
| InChI | InChI=1S/C16H32N4O/c1-2-9-19-11-5-15(6-12-19)20-10-3-4-14(13-20)16(21)18-8-7-17/h14-15H,2-13,17H2,1H3,(H,18,21) |
| InChIKey | QXASSKBNWSIMKD-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |