C15H28N4O2 — CID 63252704
N-(2-aminoethyl)-1-[2-(cyclopentylamino)-2-oxoethyl]piperidine-3-carboxamide (PubChem CID 63252704) has the molecular formula C15H28N4O2 and a molecular weight of 296.42 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-[2-(cyclopentylamino)-2-oxoethyl]piperidine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-[2-(cyclopentylamino)-2-oxoethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 63252704 |
| Molecular Formula | C15H28N4O2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | N-(2-aminoethyl)-1-[2-(cyclopentylamino)-2-oxoethyl]piperidine-3-carboxamide |
| SMILES | NCCNC(=O)C1CCCN(CC(=O)NC2CCCC2)C1 |
| InChI | InChI=1S/C15H28N4O2/c16-7-8-17-15(21)12-4-3-9-19(10-12)11-14(20)18-13-5-1-2-6-13/h12-13H,1-11,16H2,(H,17,21)(H,18,20) |
| InChIKey | KZXMBGSLJGWIAY-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |