C12H19N5O2 — CID 63257017
6-(4-pyrrolidin-2-ylpiperidin-1-yl)-2H-1,2,4-triazine-3,5-dione (PubChem CID 63257017) has the molecular formula C12H19N5O2 and a molecular weight of 265.32 g/mol. Its IUPAC name is 6-(4-pyrrolidin-2-ylpiperidin-1-yl)-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-(4-pyrrolidin-2-ylpiperidin-1-yl)-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 63257017 |
| Molecular Formula | C12H19N5O2 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 6-(4-pyrrolidin-2-ylpiperidin-1-yl)-2H-1,2,4-triazine-3,5-dione |
| SMILES | O=c1[nH]nc(N2CCC(C3CCCN3)CC2)c(=O)[nH]1 |
| InChI | InChI=1S/C12H19N5O2/c18-11-10(15-16-12(19)14-11)17-6-3-8(4-7-17)9-2-1-5-13-9/h8-9,13H,1-7H2,(H2,14,16,18,19) |
| InChIKey | ODESRFAVNYOCQT-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 93.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |