C7H6F4N2O2S — CID 63257611
N-(2-amino-5-fluorophenyl)-1,1,1-trifluoromethanesulfonamide (PubChem CID 63257611) has the molecular formula C7H6F4N2O2S and a molecular weight of 258.20 g/mol. Its IUPAC name is N-(2-amino-5-fluorophenyl)-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-(2-amino-5-fluorophenyl)-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 63257611 |
| Molecular Formula | C7H6F4N2O2S |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 258.01 |
| IUPAC Name | N-(2-amino-5-fluorophenyl)-1,1,1-trifluoromethanesulfonamide |
| SMILES | Nc1ccc(F)cc1NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C7H6F4N2O2S/c8-4-1-2-5(12)6(3-4)13-16(14,15)7(9,10)11/h1-3,13H,12H2 |
| InChIKey | WDIRLKVGVNVVCC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|