C13H19N3O — CID 63258689
3-methyl-1-(2-pyridin-4-ylethyl)-1,4-diazepan-2-one (PubChem CID 63258689) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is 3-methyl-1-(2-pyridin-4-ylethyl)-1,4-diazepan-2-one.
| Compound Name | 3-methyl-1-(2-pyridin-4-ylethyl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 63258689 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 3-methyl-1-(2-pyridin-4-ylethyl)-1,4-diazepan-2-one |
| SMILES | CC1NCCCN(CCc2ccncc2)C1=O |
| InChI | InChI=1S/C13H19N3O/c1-11-13(17)16(9-2-6-15-11)10-5-12-3-7-14-8-4-12/h3-4,7-8,11,15H,2,5-6,9-10H2,1H3 |
| InChIKey | PHJJCFPNVRYFNJ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |