About 5-(1H-imidazo[4,5-b]pyridin-2-yl)pyridin-2-amine
5-(1H-imidazo[4,5-b]pyridin-2-yl)pyridin-2-amine (PubChem CID 63259845) has the molecular formula C11H9N5
and a molecular weight of 211.23 g/mol. Its IUPAC name is 5-(1H-imidazo[4,5-b]pyridin-2-yl)pyridin-2-amine.
Molecular Properties
| Compound Name | 5-(1H-imidazo[4,5-b]pyridin-2-yl)pyridin-2-amine |
| PubChem CID | 63259845 |
| Molecular Formula | C11H9N5 |
| Molecular Weight | 211.23 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | 5-(1H-imidazo[4,5-b]pyridin-2-yl)pyridin-2-amine |
| SMILES | Nc1ccc(-c2nc3ncccc3[nH]2)cn1 |
| InChI | InChI=1S/C11H9N5/c12-9-4-3-7(6-14-9)10-15-8-2-1-5-13-11(8)16-10/h1-6H,(H2,12,14)(H,13,15,16) |
| InChIKey | FXOKOIVNWSTYBA-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.23 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(1H-imidazo[4,5-b]pyridin-2-yl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1H-imidazo[4,5-b]pyridin-2-yl)pyridin-2-amine?
The IUPAC name of 5-(1H-imidazo[4,5-b]pyridin-2-yl)pyridin-2-amine (CID 63259845) is 5-(1H-imidazo[4,5-b]pyridin-2-yl)pyridin-2-amine.
What is the SMILES notation for 5-(1H-imidazo[4,5-b]pyridin-2-yl)pyridin-2-amine?
The canonical SMILES for 5-(1H-imidazo[4,5-b]pyridin-2-yl)pyridin-2-amine is Nc1ccc(-c2nc3ncccc3[nH]2)cn1.
What is the InChIKey of 5-(1H-imidazo[4,5-b]pyridin-2-yl)pyridin-2-amine?
The InChIKey is FXOKOIVNWSTYBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N5/c12-9-4-3-7(6-14-9)10-15-8-2-1-5-13-11(8)16-10/h1-6H,(H2,12,14)(H,13,15,16).
What are the key properties of 5-(1H-imidazo[4,5-b]pyridin-2-yl)pyridin-2-amine?
5-(1H-imidazo[4,5-b]pyridin-2-yl)pyridin-2-amine has a molecular weight of 211.23 g/mol, XLogP of 1.60, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1H-imidazo[4,5-b]pyridin-2-yl)pyridin-2-amine is sourced from PubChem (CID 63259845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).