About 3-(4-cyclopropyl-1,2,4-triazol-3-yl)pyrazin-2-amine
3-(4-cyclopropyl-1,2,4-triazol-3-yl)pyrazin-2-amine (PubChem CID 63260133) has the molecular formula C9H10N6
and a molecular weight of 202.22 g/mol. Its IUPAC name is 3-(4-cyclopropyl-1,2,4-triazol-3-yl)pyrazin-2-amine.
Molecular Properties
| Compound Name | 3-(4-cyclopropyl-1,2,4-triazol-3-yl)pyrazin-2-amine |
| PubChem CID | 63260133 |
| Molecular Formula | C9H10N6 |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 3-(4-cyclopropyl-1,2,4-triazol-3-yl)pyrazin-2-amine |
| SMILES | Nc1nccnc1-c1nncn1C1CC1 |
| InChI | InChI=1S/C9H10N6/c10-8-7(11-3-4-12-8)9-14-13-5-15(9)6-1-2-6/h3-6H,1-2H2,(H2,10,12) |
| InChIKey | NCTKGBJROLZOGN-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(4-cyclopropyl-1,2,4-triazol-3-yl)pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-cyclopropyl-1,2,4-triazol-3-yl)pyrazin-2-amine?
The IUPAC name of 3-(4-cyclopropyl-1,2,4-triazol-3-yl)pyrazin-2-amine (CID 63260133) is 3-(4-cyclopropyl-1,2,4-triazol-3-yl)pyrazin-2-amine.
What is the SMILES notation for 3-(4-cyclopropyl-1,2,4-triazol-3-yl)pyrazin-2-amine?
The canonical SMILES for 3-(4-cyclopropyl-1,2,4-triazol-3-yl)pyrazin-2-amine is Nc1nccnc1-c1nncn1C1CC1.
What is the InChIKey of 3-(4-cyclopropyl-1,2,4-triazol-3-yl)pyrazin-2-amine?
The InChIKey is NCTKGBJROLZOGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N6/c10-8-7(11-3-4-12-8)9-14-13-5-15(9)6-1-2-6/h3-6H,1-2H2,(H2,10,12).
What are the key properties of 3-(4-cyclopropyl-1,2,4-triazol-3-yl)pyrazin-2-amine?
3-(4-cyclopropyl-1,2,4-triazol-3-yl)pyrazin-2-amine has a molecular weight of 202.22 g/mol, XLogP of 0.65, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-cyclopropyl-1,2,4-triazol-3-yl)pyrazin-2-amine is sourced from PubChem (CID 63260133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).