C16H17Cl2NO — CID 63260434
2-[(2,6-dichlorophenyl)methylamino]-3-phenylpropan-1-ol (PubChem CID 63260434) has the molecular formula C16H17Cl2NO and a molecular weight of 310.22 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)methylamino]-3-phenylpropan-1-ol.
| Compound Name | 2-[(2,6-dichlorophenyl)methylamino]-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 63260434 |
| Molecular Formula | C16H17Cl2NO |
| Molecular Weight | 310.22 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)methylamino]-3-phenylpropan-1-ol |
| SMILES | OCC(Cc1ccccc1)NCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H17Cl2NO/c17-15-7-4-8-16(18)14(15)10-19-13(11-20)9-12-5-2-1-3-6-12/h1-8,13,19-20H,9-11H2 |
| InChIKey | ZULZDOXXULJAGF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.22 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |