C16H21NO2 — CID 63261072
N-(1-hydroxy-3-phenylpropan-2-yl)cyclohex-3-ene-1-carboxamide (PubChem CID 63261072) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is N-(1-hydroxy-3-phenylpropan-2-yl)cyclohex-3-ene-1-carboxamide.
| Compound Name | N-(1-hydroxy-3-phenylpropan-2-yl)cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 63261072 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | N-(1-hydroxy-3-phenylpropan-2-yl)cyclohex-3-ene-1-carboxamide |
| SMILES | O=C(NC(CO)Cc1ccccc1)C1CC=CCC1 |
| InChI | InChI=1S/C16H21NO2/c18-12-15(11-13-7-3-1-4-8-13)17-16(19)14-9-5-2-6-10-14/h1-5,7-8,14-15,18H,6,9-12H2,(H,17,19) |
| InChIKey | KHNUOHYSIZLIKV-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|