About 3-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]pyrazine-2-carboxylic acid
3-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]pyrazine-2-carboxylic acid (PubChem CID 63262078) has the molecular formula C13H12N4O4
and a molecular weight of 288.26 g/mol. Its IUPAC name is 3-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]pyrazine-2-carboxylic acid.
Molecular Properties
| Compound Name | 3-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]pyrazine-2-carboxylic acid |
| PubChem CID | 63262078 |
| Molecular Formula | C13H12N4O4 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 3-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]pyrazine-2-carboxylic acid |
| SMILES | Cc1cc(C)c(C(=O)Nc2nccnc2C(=O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C13H12N4O4/c1-6-5-7(2)16-11(18)8(6)12(19)17-10-9(13(20)21)14-3-4-15-10/h3-5H,1-2H3,(H,16,18)(H,20,21)(H,15,17,19) |
| InChIKey | XSRPAEVAHJVZCN-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]pyrazine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]pyrazine-2-carboxylic acid?
The IUPAC name of 3-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]pyrazine-2-carboxylic acid (CID 63262078) is 3-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]pyrazine-2-carboxylic acid.
What is the SMILES notation for 3-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]pyrazine-2-carboxylic acid?
The canonical SMILES for 3-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]pyrazine-2-carboxylic acid is Cc1cc(C)c(C(=O)Nc2nccnc2C(=O)O)c(=O)[nH]1.
What is the InChIKey of 3-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]pyrazine-2-carboxylic acid?
The InChIKey is XSRPAEVAHJVZCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N4O4/c1-6-5-7(2)16-11(18)8(6)12(19)17-10-9(13(20)21)14-3-4-15-10/h3-5H,1-2H3,(H,16,18)(H,20,21)(H,15,17,19).
What are the key properties of 3-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]pyrazine-2-carboxylic acid?
3-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]pyrazine-2-carboxylic acid has a molecular weight of 288.26 g/mol, XLogP of 0.73, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)amino]pyrazine-2-carboxylic acid is sourced from PubChem (CID 63262078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).