C17H20N2O2 — CID 63262572
4-[N-(2-pyridin-3-ylethyl)anilino]butanoic acid (PubChem CID 63262572) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 4-[N-(2-pyridin-3-ylethyl)anilino]butanoic acid.
| Compound Name | 4-[N-(2-pyridin-3-ylethyl)anilino]butanoic acid |
|---|---|
| PubChem CID | 63262572 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 4-[N-(2-pyridin-3-ylethyl)anilino]butanoic acid |
| SMILES | O=C(O)CCCN(CCc1cccnc1)c1ccccc1 |
| InChI | InChI=1S/C17H20N2O2/c20-17(21)9-5-12-19(16-7-2-1-3-8-16)13-10-15-6-4-11-18-14-15/h1-4,6-8,11,14H,5,9-10,12-13H2,(H,20,21) |
| InChIKey | QVRBRZINBCFGQL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |