C12H18N2O — CID 63262678
1-(2-pyridin-3-ylethyl)piperidin-3-ol (PubChem CID 63262678) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 1-(2-pyridin-3-ylethyl)piperidin-3-ol.
| Compound Name | 1-(2-pyridin-3-ylethyl)piperidin-3-ol |
|---|---|
| PubChem CID | 63262678 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 1-(2-pyridin-3-ylethyl)piperidin-3-ol |
| SMILES | OC1CCCN(CCc2cccnc2)C1 |
| InChI | InChI=1S/C12H18N2O/c15-12-4-2-7-14(10-12)8-5-11-3-1-6-13-9-11/h1,3,6,9,12,15H,2,4-5,7-8,10H2 |
| InChIKey | LNTBLFRDOHRJDH-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |