About N-(4-chlorophenyl)-4-[(2,6-dimethyl-4-pyridinyl)methyl]phthalazin-1-amine
N-(4-chlorophenyl)-4-[(2,6-dimethyl-4-pyridinyl)methyl]phthalazin-1-amine (PubChem CID 6326420) has the molecular formula C22H19ClN4
and a molecular weight of 374.88 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[(2,6-dimethyl-4-pyridinyl)methyl]phthalazin-1-amine.
Molecular Properties
| Compound Name | N-(4-chlorophenyl)-4-[(2,6-dimethyl-4-pyridinyl)methyl]phthalazin-1-amine |
| PubChem CID | 6326420 |
| Molecular Formula | C22H19ClN4 |
| Molecular Weight | 374.88 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | N-(4-chlorophenyl)-4-[(2,6-dimethyl-4-pyridinyl)methyl]phthalazin-1-amine |
| SMILES | Cc1cc(Cc2nnc(Nc3ccc(Cl)cc3)c3ccccc23)cc(C)n1 |
| InChI | InChI=1S/C22H19ClN4/c1-14-11-16(12-15(2)24-14)13-21-19-5-3-4-6-20(19)22(27-26-21)25-18-9-7-17(23)8-10-18/h3-12H,13H2,1-2H3,(H,25,27) |
| InChIKey | PXVHGHAKRNHTTB-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.88 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(4-chlorophenyl)-4-[(2,6-dimethyl-4-pyridinyl)methyl]phthalazin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-chlorophenyl)-4-[(2,6-dimethyl-4-pyridinyl)methyl]phthalazin-1-amine?
The IUPAC name of N-(4-chlorophenyl)-4-[(2,6-dimethyl-4-pyridinyl)methyl]phthalazin-1-amine (CID 6326420) is N-(4-chlorophenyl)-4-[(2,6-dimethyl-4-pyridinyl)methyl]phthalazin-1-amine.
What is the SMILES notation for N-(4-chlorophenyl)-4-[(2,6-dimethyl-4-pyridinyl)methyl]phthalazin-1-amine?
The canonical SMILES for N-(4-chlorophenyl)-4-[(2,6-dimethyl-4-pyridinyl)methyl]phthalazin-1-amine is Cc1cc(Cc2nnc(Nc3ccc(Cl)cc3)c3ccccc23)cc(C)n1.
What is the InChIKey of N-(4-chlorophenyl)-4-[(2,6-dimethyl-4-pyridinyl)methyl]phthalazin-1-amine?
The InChIKey is PXVHGHAKRNHTTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19ClN4/c1-14-11-16(12-15(2)24-14)13-21-19-5-3-4-6-20(19)22(27-26-21)25-18-9-7-17(23)8-10-18/h3-12H,13H2,1-2H3,(H,25,27).
What are the key properties of N-(4-chlorophenyl)-4-[(2,6-dimethyl-4-pyridinyl)methyl]phthalazin-1-amine?
N-(4-chlorophenyl)-4-[(2,6-dimethyl-4-pyridinyl)methyl]phthalazin-1-amine has a molecular weight of 374.88 g/mol, XLogP of 5.63, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-chlorophenyl)-4-[(2,6-dimethyl-4-pyridinyl)methyl]phthalazin-1-amine is sourced from PubChem (CID 6326420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).