About N-(imidazo[1,2-a]pyrimidin-2-ylmethyl)-N-methyl-2-piperazin-1-ylethanamine
N-(imidazo[1,2-a]pyrimidin-2-ylmethyl)-N-methyl-2-piperazin-1-ylethanamine (PubChem CID 63265435) has the molecular formula C14H22N6
and a molecular weight of 274.37 g/mol. Its IUPAC name is N-(imidazo[1,2-a]pyrimidin-2-ylmethyl)-N-methyl-2-piperazin-1-ylethanamine.
Molecular Properties
| Compound Name | N-(imidazo[1,2-a]pyrimidin-2-ylmethyl)-N-methyl-2-piperazin-1-ylethanamine |
| PubChem CID | 63265435 |
| Molecular Formula | C14H22N6 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | N-(imidazo[1,2-a]pyrimidin-2-ylmethyl)-N-methyl-2-piperazin-1-ylethanamine |
| SMILES | CN(CCN1CCNCC1)Cc1cn2cccnc2n1 |
| InChI | InChI=1S/C14H22N6/c1-18(9-10-19-7-4-15-5-8-19)11-13-12-20-6-2-3-16-14(20)17-13/h2-3,6,12,15H,4-5,7-11H2,1H3 |
| InChIKey | TXAUDYKEZSVSRY-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 48.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(imidazo[1,2-a]pyrimidin-2-ylmethyl)-N-methyl-2-piperazin-1-ylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(imidazo[1,2-a]pyrimidin-2-ylmethyl)-N-methyl-2-piperazin-1-ylethanamine?
The IUPAC name of N-(imidazo[1,2-a]pyrimidin-2-ylmethyl)-N-methyl-2-piperazin-1-ylethanamine (CID 63265435) is N-(imidazo[1,2-a]pyrimidin-2-ylmethyl)-N-methyl-2-piperazin-1-ylethanamine.
What is the SMILES notation for N-(imidazo[1,2-a]pyrimidin-2-ylmethyl)-N-methyl-2-piperazin-1-ylethanamine?
The canonical SMILES for N-(imidazo[1,2-a]pyrimidin-2-ylmethyl)-N-methyl-2-piperazin-1-ylethanamine is CN(CCN1CCNCC1)Cc1cn2cccnc2n1.
What is the InChIKey of N-(imidazo[1,2-a]pyrimidin-2-ylmethyl)-N-methyl-2-piperazin-1-ylethanamine?
The InChIKey is TXAUDYKEZSVSRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N6/c1-18(9-10-19-7-4-15-5-8-19)11-13-12-20-6-2-3-16-14(20)17-13/h2-3,6,12,15H,4-5,7-11H2,1H3.
What are the key properties of N-(imidazo[1,2-a]pyrimidin-2-ylmethyl)-N-methyl-2-piperazin-1-ylethanamine?
N-(imidazo[1,2-a]pyrimidin-2-ylmethyl)-N-methyl-2-piperazin-1-ylethanamine has a molecular weight of 274.37 g/mol, XLogP of 0.07, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(imidazo[1,2-a]pyrimidin-2-ylmethyl)-N-methyl-2-piperazin-1-ylethanamine is sourced from PubChem (CID 63265435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).