C13H20FN3O2S — CID 63265596
3-fluoro-N-methyl-N-(2-piperazin-1-ylethyl)benzenesulfonamide (PubChem CID 63265596) has the molecular formula C13H20FN3O2S and a molecular weight of 301.39 g/mol. Its IUPAC name is 3-fluoro-N-methyl-N-(2-piperazin-1-ylethyl)benzenesulfonamide.
| Compound Name | 3-fluoro-N-methyl-N-(2-piperazin-1-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 63265596 |
| Molecular Formula | C13H20FN3O2S |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 3-fluoro-N-methyl-N-(2-piperazin-1-ylethyl)benzenesulfonamide |
| SMILES | CN(CCN1CCNCC1)S(=O)(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C13H20FN3O2S/c1-16(9-10-17-7-5-15-6-8-17)20(18,19)13-4-2-3-12(14)11-13/h2-4,11,15H,5-10H2,1H3 |
| InChIKey | JDIUAYDYLWALRD-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |