C18H15N5O2 — CID 6326586
2-(2-hydroxyimino-2-phenylethyl)-1-oxo-8,9-dihydro-7H-pyrimido[5,4-a]pyrrolizine-5-carbonitrile (PubChem CID 6326586) has the molecular formula C18H15N5O2 and a molecular weight of 333.35 g/mol. Its IUPAC name is 2-(2-hydroxyimino-2-phenylethyl)-1-oxo-8,9-dihydro-7H-pyrimido[5,4-a]pyrrolizine-5-carbonitrile.
| Compound Name | 2-(2-hydroxyimino-2-phenylethyl)-1-oxo-8,9-dihydro-7H-pyrimido[5,4-a]pyrrolizine-5-carbonitrile |
|---|---|
| PubChem CID | 6326586 |
| Molecular Formula | C18H15N5O2 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 2-(2-hydroxyimino-2-phenylethyl)-1-oxo-8,9-dihydro-7H-pyrimido[5,4-a]pyrrolizine-5-carbonitrile |
| SMILES | N#Cc1c2ncn(CC(=NO)c3ccccc3)c(=O)c2c2n1CCC2 |
| InChI | InChI=1S/C18H15N5O2/c19-9-15-17-16(14-7-4-8-23(14)15)18(24)22(11-20-17)10-13(21-25)12-5-2-1-3-6-12/h1-3,5-6,11,25H,4,7-8,10H2 |
| InChIKey | ISSDTNMQTANTFB-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 96.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|