(Z)-2,3-dimethyl-4-oxo-4-(propylamino)but-2-enoic acid

C9H15NO3 — CID 63267033

IUPAC(Z)-2,3-dimethyl-4-oxo-4-(propylamino)but-2-enoic acid
SMILESCCCNC(=O)/C(C)=C(/C)C(=O)O
InChIInChI=1S/C9H15NO3/c1-4-5-10-8(11)6(2)7(3)9(12)13/h4-5H2,1-3H3,(H,10,11)(H,12,13)/b7-6-
InChIKeyDBRDWBKHKSEVPL-SREVYHEPSA-N
MW185.22 g/mol
LogP0.93
Rot. Bonds4

About (Z)-2,3-dimethyl-4-oxo-4-(propylamino)but-2-enoic acid

(Z)-2,3-dimethyl-4-oxo-4-(propylamino)but-2-enoic acid (PubChem CID 63267033) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is (Z)-2,3-dimethyl-4-oxo-4-(propylamino)but-2-enoic acid.

Molecular Properties

Compound Name(Z)-2,3-dimethyl-4-oxo-4-(propylamino)but-2-enoic acid
PubChem CID63267033
Molecular FormulaC9H15NO3
Molecular Weight185.22 g/mol
Exact Mass185.11
IUPAC Name(Z)-2,3-dimethyl-4-oxo-4-(propylamino)but-2-enoic acid
SMILESCCCNC(=O)/C(C)=C(/C)C(=O)O
InChIInChI=1S/C9H15NO3/c1-4-5-10-8(11)6(2)7(3)9(12)13/h4-5H2,1-3H3,(H,10,11)(H,12,13)/b7-6-
InChIKeyDBRDWBKHKSEVPL-SREVYHEPSA-N
XLogP0.93
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500185.22
LogP ≤ 50.93
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (Z)-2,3-dimethyl-4-oxo-4-(propylamino)but-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z)-2,3-dimethyl-4-oxo-4-(propylamino)but-2-enoic acid?
The IUPAC name of (Z)-2,3-dimethyl-4-oxo-4-(propylamino)but-2-enoic acid (CID 63267033) is (Z)-2,3-dimethyl-4-oxo-4-(propylamino)but-2-enoic acid.
What is the SMILES notation for (Z)-2,3-dimethyl-4-oxo-4-(propylamino)but-2-enoic acid?
The canonical SMILES for (Z)-2,3-dimethyl-4-oxo-4-(propylamino)but-2-enoic acid is CCCNC(=O)/C(C)=C(/C)C(=O)O.
What is the InChIKey of (Z)-2,3-dimethyl-4-oxo-4-(propylamino)but-2-enoic acid?
The InChIKey is DBRDWBKHKSEVPL-SREVYHEPSA-N. The full InChI is InChI=1S/C9H15NO3/c1-4-5-10-8(11)6(2)7(3)9(12)13/h4-5H2,1-3H3,(H,10,11)(H,12,13)/b7-6-.
What are the key properties of (Z)-2,3-dimethyl-4-oxo-4-(propylamino)but-2-enoic acid?
(Z)-2,3-dimethyl-4-oxo-4-(propylamino)but-2-enoic acid has a molecular weight of 185.22 g/mol, XLogP of 0.93, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2,3-dimethyl-4-oxo-4-(propylamino)but-2-enoic acid is sourced from PubChem (CID 63267033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).