C7H10O7 — CID 6326746
(1S,2R)-1-hydroxybutane-1,2,4-tricarboxylic acid (PubChem CID 6326746) has the molecular formula C7H10O7 and a molecular weight of 206.15 g/mol. Its IUPAC name is (1S,2R)-1-hydroxybutane-1,2,4-tricarboxylic acid.
| Compound Name | (1S,2R)-1-hydroxybutane-1,2,4-tricarboxylic acid |
|---|---|
| PubChem CID | 6326746 |
| Molecular Formula | C7H10O7 |
| Molecular Weight | 206.15 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | (1S,2R)-1-hydroxybutane-1,2,4-tricarboxylic acid |
| SMILES | O=C(O)CCC(C(=O)O)[C@H](O)C(=O)O |
| InChI | InChI=1S/C7H10O7/c8-4(9)2-1-3(6(11)12)5(10)7(13)14/h3,5,10H,1-2H2,(H,8,9)(H,11,12)(H,13,14)/t3?,5-/m0/s1 |
| InChIKey | OEJZZCGRGVFWHK-PVPKANODSA-N |
| XLogP | -1.00 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.15 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |