C9H7N5S — CID 63268954
4-(3H-imidazo[4,5-c]pyridin-2-yl)-1,3-thiazol-2-amine (PubChem CID 63268954) has the molecular formula C9H7N5S and a molecular weight of 217.26 g/mol. Its IUPAC name is 4-(3H-imidazo[4,5-c]pyridin-2-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-(3H-imidazo[4,5-c]pyridin-2-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 63268954 |
| Molecular Formula | C9H7N5S |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 4-(3H-imidazo[4,5-c]pyridin-2-yl)-1,3-thiazol-2-amine |
| SMILES | Nc1nc(-c2nc3ccncc3[nH]2)cs1 |
| InChI | InChI=1S/C9H7N5S/c10-9-14-7(4-15-9)8-12-5-1-2-11-3-6(5)13-8/h1-4H,(H2,10,14)(H,12,13) |
| InChIKey | WLFMPHAKWJMHDQ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |