About Seleno-(DL)-cysteine
Seleno-(DL)-cysteine (PubChem CID 6326972) has the molecular formula C3H6NO2Se
and a molecular weight of 167.05 g/mol.
Molecular Properties
| Compound Name | Seleno-(DL)-cysteine |
| PubChem CID | 6326972 |
| Molecular Formula | C3H6NO2Se |
| Molecular Weight | 167.05 g/mol |
| Exact Mass | 167.96 |
| IUPAC Name | — |
| SMILES | NC(C[Se])C(=O)O |
| InChI | InChI=1S/C3H6NO2Se/c4-2(1-7)3(5)6/h2H,1,4H2,(H,5,6) |
| InChIKey | FDKWRPBBCBCIGA-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.05 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Seleno-(DL)-cysteine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Seleno-(DL)-cysteine?
The IUPAC name of Seleno-(DL)-cysteine (CID 6326972) is not available.
What is the SMILES notation for Seleno-(DL)-cysteine?
The canonical SMILES for Seleno-(DL)-cysteine is NC(C[Se])C(=O)O.
What is the InChIKey of Seleno-(DL)-cysteine?
The InChIKey is FDKWRPBBCBCIGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6NO2Se/c4-2(1-7)3(5)6/h2H,1,4H2,(H,5,6).
What are the key properties of Seleno-(DL)-cysteine?
Seleno-(DL)-cysteine has a molecular weight of 167.05 g/mol, XLogP of -1.01, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Seleno-(DL)-cysteine is sourced from PubChem (CID 6326972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).