About 2-(2-hydroxyethyl)-4,5-dimethyl-1H-pyridazine-3,6-dione
2-(2-hydroxyethyl)-4,5-dimethyl-1H-pyridazine-3,6-dione (PubChem CID 63271084) has the molecular formula C8H12N2O3
and a molecular weight of 184.19 g/mol. Its IUPAC name is 2-(2-hydroxyethyl)-4,5-dimethyl-1H-pyridazine-3,6-dione.
Molecular Properties
| Compound Name | 2-(2-hydroxyethyl)-4,5-dimethyl-1H-pyridazine-3,6-dione |
| PubChem CID | 63271084 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 2-(2-hydroxyethyl)-4,5-dimethyl-1H-pyridazine-3,6-dione |
| SMILES | Cc1c(C)c(=O)n(CCO)[nH]c1=O |
| InChI | InChI=1S/C8H12N2O3/c1-5-6(2)8(13)10(3-4-11)9-7(5)12/h11H,3-4H2,1-2H3,(H,9,12) |
| InChIKey | QDNGODIJAHEHBY-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-hydroxyethyl)-4,5-dimethyl-1H-pyridazine-3,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxyethyl)-4,5-dimethyl-1H-pyridazine-3,6-dione?
The IUPAC name of 2-(2-hydroxyethyl)-4,5-dimethyl-1H-pyridazine-3,6-dione (CID 63271084) is 2-(2-hydroxyethyl)-4,5-dimethyl-1H-pyridazine-3,6-dione.
What is the SMILES notation for 2-(2-hydroxyethyl)-4,5-dimethyl-1H-pyridazine-3,6-dione?
The canonical SMILES for 2-(2-hydroxyethyl)-4,5-dimethyl-1H-pyridazine-3,6-dione is Cc1c(C)c(=O)n(CCO)[nH]c1=O.
What is the InChIKey of 2-(2-hydroxyethyl)-4,5-dimethyl-1H-pyridazine-3,6-dione?
The InChIKey is QDNGODIJAHEHBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O3/c1-5-6(2)8(13)10(3-4-11)9-7(5)12/h11H,3-4H2,1-2H3,(H,9,12).
What are the key properties of 2-(2-hydroxyethyl)-4,5-dimethyl-1H-pyridazine-3,6-dione?
2-(2-hydroxyethyl)-4,5-dimethyl-1H-pyridazine-3,6-dione has a molecular weight of 184.19 g/mol, XLogP of -0.85, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxyethyl)-4,5-dimethyl-1H-pyridazine-3,6-dione is sourced from PubChem (CID 63271084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).