C12H11Cl2N3O2 — CID 63271123
2-[(3,6-dichloro-2-pyridinyl)methyl]-4,5-dimethyl-1H-pyridazine-3,6-dione (PubChem CID 63271123) has the molecular formula C12H11Cl2N3O2 and a molecular weight of 300.15 g/mol. Its IUPAC name is 2-[(3,6-dichloro-2-pyridinyl)methyl]-4,5-dimethyl-1H-pyridazine-3,6-dione.
| Compound Name | 2-[(3,6-dichloro-2-pyridinyl)methyl]-4,5-dimethyl-1H-pyridazine-3,6-dione |
|---|---|
| PubChem CID | 63271123 |
| Molecular Formula | C12H11Cl2N3O2 |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 2-[(3,6-dichloro-2-pyridinyl)methyl]-4,5-dimethyl-1H-pyridazine-3,6-dione |
| SMILES | Cc1c(C)c(=O)n(Cc2nc(Cl)ccc2Cl)[nH]c1=O |
| InChI | InChI=1S/C12H11Cl2N3O2/c1-6-7(2)12(19)17(16-11(6)18)5-9-8(13)3-4-10(14)15-9/h3-4H,5H2,1-2H3,(H,16,18) |
| InChIKey | UJFXQRWNMXKWGR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|