About Hexaphenylditin
Hexaphenylditin (PubChem CID 6327129) has the molecular formula C36H30Sn2
and a molecular weight of 700.06 g/mol.
Molecular Properties
| Compound Name | Hexaphenylditin |
| PubChem CID | 6327129 |
| Molecular Formula | C36H30Sn2 |
| Molecular Weight | 700.06 g/mol |
| Exact Mass | 702.04 |
| IUPAC Name | — |
| SMILES | c1ccc([Sn](c2ccccc2)c2ccccc2)cc1.c1ccc([Sn](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/6C6H5.2Sn/c6*1-2-4-6-5-3-1;;/h6*1-5H;; |
| InChIKey | UAPQJVJCJITJET-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 700.06 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze Hexaphenylditin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Hexaphenylditin?
The IUPAC name of Hexaphenylditin (CID 6327129) is not available.
What is the SMILES notation for Hexaphenylditin?
The canonical SMILES for Hexaphenylditin is c1ccc([Sn](c2ccccc2)c2ccccc2)cc1.c1ccc([Sn](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of Hexaphenylditin?
The InChIKey is UAPQJVJCJITJET-UHFFFAOYSA-N. The full InChI is InChI=1S/6C6H5.2Sn/c6*1-2-4-6-5-3-1;;/h6*1-5H;;.
What are the key properties of Hexaphenylditin?
Hexaphenylditin has a molecular weight of 700.06 g/mol, XLogP of 4.41, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Hexaphenylditin is sourced from PubChem (CID 6327129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).