About N-(2-cyanoethyl)-3-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)-N-methylpropanamide
N-(2-cyanoethyl)-3-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)-N-methylpropanamide (PubChem CID 63271354) has the molecular formula C13H18N4O3
and a molecular weight of 278.31 g/mol. Its IUPAC name is N-(2-cyanoethyl)-3-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)-N-methylpropanamide.
Molecular Properties
| Compound Name | N-(2-cyanoethyl)-3-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)-N-methylpropanamide |
| PubChem CID | 63271354 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | N-(2-cyanoethyl)-3-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)-N-methylpropanamide |
| SMILES | Cc1c(C)c(=O)n(CCC(=O)N(C)CCC#N)[nH]c1=O |
| InChI | InChI=1S/C13H18N4O3/c1-9-10(2)13(20)17(15-12(9)19)8-5-11(18)16(3)7-4-6-14/h4-5,7-8H2,1-3H3,(H,15,19) |
| InChIKey | GXKJJPGNTVOTSU-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 98.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2-cyanoethyl)-3-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)-N-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-cyanoethyl)-3-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)-N-methylpropanamide?
The IUPAC name of N-(2-cyanoethyl)-3-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)-N-methylpropanamide (CID 63271354) is N-(2-cyanoethyl)-3-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)-N-methylpropanamide.
What is the SMILES notation for N-(2-cyanoethyl)-3-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)-N-methylpropanamide?
The canonical SMILES for N-(2-cyanoethyl)-3-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)-N-methylpropanamide is Cc1c(C)c(=O)n(CCC(=O)N(C)CCC#N)[nH]c1=O.
What is the InChIKey of N-(2-cyanoethyl)-3-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)-N-methylpropanamide?
The InChIKey is GXKJJPGNTVOTSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4O3/c1-9-10(2)13(20)17(15-12(9)19)8-5-11(18)16(3)7-4-6-14/h4-5,7-8H2,1-3H3,(H,15,19).
What are the key properties of N-(2-cyanoethyl)-3-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)-N-methylpropanamide?
N-(2-cyanoethyl)-3-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)-N-methylpropanamide has a molecular weight of 278.31 g/mol, XLogP of -0.08, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-cyanoethyl)-3-(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)-N-methylpropanamide is sourced from PubChem (CID 63271354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).