About 3-chloro-6-(3,5-dimethoxyphenoxy)-4,5-dimethylpyridazine
3-chloro-6-(3,5-dimethoxyphenoxy)-4,5-dimethylpyridazine (PubChem CID 63271701) has the molecular formula C14H15ClN2O3
and a molecular weight of 294.74 g/mol. Its IUPAC name is 3-chloro-6-(3,5-dimethoxyphenoxy)-4,5-dimethylpyridazine.
Molecular Properties
| Compound Name | 3-chloro-6-(3,5-dimethoxyphenoxy)-4,5-dimethylpyridazine |
| PubChem CID | 63271701 |
| Molecular Formula | C14H15ClN2O3 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 3-chloro-6-(3,5-dimethoxyphenoxy)-4,5-dimethylpyridazine |
| SMILES | COc1cc(OC)cc(Oc2nnc(Cl)c(C)c2C)c1 |
| InChI | InChI=1S/C14H15ClN2O3/c1-8-9(2)14(17-16-13(8)15)20-12-6-10(18-3)5-11(7-12)19-4/h5-7H,1-4H3 |
| InChIKey | OWTJNPHEVRVLSN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-chloro-6-(3,5-dimethoxyphenoxy)-4,5-dimethylpyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-6-(3,5-dimethoxyphenoxy)-4,5-dimethylpyridazine?
The IUPAC name of 3-chloro-6-(3,5-dimethoxyphenoxy)-4,5-dimethylpyridazine (CID 63271701) is 3-chloro-6-(3,5-dimethoxyphenoxy)-4,5-dimethylpyridazine.
What is the SMILES notation for 3-chloro-6-(3,5-dimethoxyphenoxy)-4,5-dimethylpyridazine?
The canonical SMILES for 3-chloro-6-(3,5-dimethoxyphenoxy)-4,5-dimethylpyridazine is COc1cc(OC)cc(Oc2nnc(Cl)c(C)c2C)c1.
What is the InChIKey of 3-chloro-6-(3,5-dimethoxyphenoxy)-4,5-dimethylpyridazine?
The InChIKey is OWTJNPHEVRVLSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15ClN2O3/c1-8-9(2)14(17-16-13(8)15)20-12-6-10(18-3)5-11(7-12)19-4/h5-7H,1-4H3.
What are the key properties of 3-chloro-6-(3,5-dimethoxyphenoxy)-4,5-dimethylpyridazine?
3-chloro-6-(3,5-dimethoxyphenoxy)-4,5-dimethylpyridazine has a molecular weight of 294.74 g/mol, XLogP of 3.56, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-6-(3,5-dimethoxyphenoxy)-4,5-dimethylpyridazine is sourced from PubChem (CID 63271701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).