C13H14ClN3 — CID 63271969
N-benzyl-6-chloro-4,5-dimethylpyridazin-3-amine (PubChem CID 63271969) has the molecular formula C13H14ClN3 and a molecular weight of 247.73 g/mol. Its IUPAC name is N-benzyl-6-chloro-4,5-dimethylpyridazin-3-amine.
| Compound Name | N-benzyl-6-chloro-4,5-dimethylpyridazin-3-amine |
|---|---|
| PubChem CID | 63271969 |
| Molecular Formula | C13H14ClN3 |
| Molecular Weight | 247.73 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | N-benzyl-6-chloro-4,5-dimethylpyridazin-3-amine |
| SMILES | Cc1c(Cl)nnc(NCc2ccccc2)c1C |
| InChI | InChI=1S/C13H14ClN3/c1-9-10(2)13(17-16-12(9)14)15-8-11-6-4-3-5-7-11/h3-7H,8H2,1-2H3,(H,15,17) |
| InChIKey | CVHGGBCWBQFFCZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.73 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |