C13H20ClN3 — CID 63271977
3-chloro-6-(3-ethylpiperidin-1-yl)-4,5-dimethylpyridazine (PubChem CID 63271977) has the molecular formula C13H20ClN3 and a molecular weight of 253.78 g/mol. Its IUPAC name is 3-chloro-6-(3-ethylpiperidin-1-yl)-4,5-dimethylpyridazine.
| Compound Name | 3-chloro-6-(3-ethylpiperidin-1-yl)-4,5-dimethylpyridazine |
|---|---|
| PubChem CID | 63271977 |
| Molecular Formula | C13H20ClN3 |
| Molecular Weight | 253.78 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 3-chloro-6-(3-ethylpiperidin-1-yl)-4,5-dimethylpyridazine |
| SMILES | CCC1CCCN(c2nnc(Cl)c(C)c2C)C1 |
| InChI | InChI=1S/C13H20ClN3/c1-4-11-6-5-7-17(8-11)13-10(3)9(2)12(14)15-16-13/h11H,4-8H2,1-3H3 |
| InChIKey | RRRMOVNJFQNJCH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.78 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |