About 3-[(6-chloro-4,5-dimethylpyridazin-3-yl)-cyclopropylamino]propanenitrile
3-[(6-chloro-4,5-dimethylpyridazin-3-yl)-cyclopropylamino]propanenitrile (PubChem CID 63271985) has the molecular formula C12H15ClN4
and a molecular weight of 250.73 g/mol. Its IUPAC name is 3-[(6-chloro-4,5-dimethylpyridazin-3-yl)-cyclopropylamino]propanenitrile.
Molecular Properties
| Compound Name | 3-[(6-chloro-4,5-dimethylpyridazin-3-yl)-cyclopropylamino]propanenitrile |
| PubChem CID | 63271985 |
| Molecular Formula | C12H15ClN4 |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 3-[(6-chloro-4,5-dimethylpyridazin-3-yl)-cyclopropylamino]propanenitrile |
| SMILES | Cc1c(Cl)nnc(N(CCC#N)C2CC2)c1C |
| InChI | InChI=1S/C12H15ClN4/c1-8-9(2)12(16-15-11(8)13)17(7-3-6-14)10-4-5-10/h10H,3-5,7H2,1-2H3 |
| InChIKey | HCNNRSJJRCVTSH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 52.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(6-chloro-4,5-dimethylpyridazin-3-yl)-cyclopropylamino]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(6-chloro-4,5-dimethylpyridazin-3-yl)-cyclopropylamino]propanenitrile?
The IUPAC name of 3-[(6-chloro-4,5-dimethylpyridazin-3-yl)-cyclopropylamino]propanenitrile (CID 63271985) is 3-[(6-chloro-4,5-dimethylpyridazin-3-yl)-cyclopropylamino]propanenitrile.
What is the SMILES notation for 3-[(6-chloro-4,5-dimethylpyridazin-3-yl)-cyclopropylamino]propanenitrile?
The canonical SMILES for 3-[(6-chloro-4,5-dimethylpyridazin-3-yl)-cyclopropylamino]propanenitrile is Cc1c(Cl)nnc(N(CCC#N)C2CC2)c1C.
What is the InChIKey of 3-[(6-chloro-4,5-dimethylpyridazin-3-yl)-cyclopropylamino]propanenitrile?
The InChIKey is HCNNRSJJRCVTSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClN4/c1-8-9(2)12(16-15-11(8)13)17(7-3-6-14)10-4-5-10/h10H,3-5,7H2,1-2H3.
What are the key properties of 3-[(6-chloro-4,5-dimethylpyridazin-3-yl)-cyclopropylamino]propanenitrile?
3-[(6-chloro-4,5-dimethylpyridazin-3-yl)-cyclopropylamino]propanenitrile has a molecular weight of 250.73 g/mol, XLogP of 2.63, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(6-chloro-4,5-dimethylpyridazin-3-yl)-cyclopropylamino]propanenitrile is sourced from PubChem (CID 63271985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).