About 5-[(6-chloro-4,5-dimethylpyridazin-3-yl)amino]isoindole-1,3-dione
5-[(6-chloro-4,5-dimethylpyridazin-3-yl)amino]isoindole-1,3-dione (PubChem CID 63272049) has the molecular formula C14H11ClN4O2
and a molecular weight of 302.72 g/mol. Its IUPAC name is 5-[(6-chloro-4,5-dimethylpyridazin-3-yl)amino]isoindole-1,3-dione.
Molecular Properties
| Compound Name | 5-[(6-chloro-4,5-dimethylpyridazin-3-yl)amino]isoindole-1,3-dione |
| PubChem CID | 63272049 |
| Molecular Formula | C14H11ClN4O2 |
| Molecular Weight | 302.72 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 5-[(6-chloro-4,5-dimethylpyridazin-3-yl)amino]isoindole-1,3-dione |
| SMILES | Cc1c(Cl)nnc(Nc2ccc3c(c2)C(=O)NC3=O)c1C |
| InChI | InChI=1S/C14H11ClN4O2/c1-6-7(2)12(19-18-11(6)15)16-8-3-4-9-10(5-8)14(21)17-13(9)20/h3-5H,1-2H3,(H,16,19)(H,17,20,21) |
| InChIKey | CRUFSAAQLHBELN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.72 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 5-[(6-chloro-4,5-dimethylpyridazin-3-yl)amino]isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(6-chloro-4,5-dimethylpyridazin-3-yl)amino]isoindole-1,3-dione?
The IUPAC name of 5-[(6-chloro-4,5-dimethylpyridazin-3-yl)amino]isoindole-1,3-dione (CID 63272049) is 5-[(6-chloro-4,5-dimethylpyridazin-3-yl)amino]isoindole-1,3-dione.
What is the SMILES notation for 5-[(6-chloro-4,5-dimethylpyridazin-3-yl)amino]isoindole-1,3-dione?
The canonical SMILES for 5-[(6-chloro-4,5-dimethylpyridazin-3-yl)amino]isoindole-1,3-dione is Cc1c(Cl)nnc(Nc2ccc3c(c2)C(=O)NC3=O)c1C.
What is the InChIKey of 5-[(6-chloro-4,5-dimethylpyridazin-3-yl)amino]isoindole-1,3-dione?
The InChIKey is CRUFSAAQLHBELN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11ClN4O2/c1-6-7(2)12(19-18-11(6)15)16-8-3-4-9-10(5-8)14(21)17-13(9)20/h3-5H,1-2H3,(H,16,19)(H,17,20,21).
What are the key properties of 5-[(6-chloro-4,5-dimethylpyridazin-3-yl)amino]isoindole-1,3-dione?
5-[(6-chloro-4,5-dimethylpyridazin-3-yl)amino]isoindole-1,3-dione has a molecular weight of 302.72 g/mol, XLogP of 2.37, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(6-chloro-4,5-dimethylpyridazin-3-yl)amino]isoindole-1,3-dione is sourced from PubChem (CID 63272049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).