C16H16BrNO — CID 63272318
8-bromo-5-methoxy-3-phenyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 63272318) has the molecular formula C16H16BrNO and a molecular weight of 318.21 g/mol. Its IUPAC name is 8-bromo-5-methoxy-3-phenyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 8-bromo-5-methoxy-3-phenyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 63272318 |
| Molecular Formula | C16H16BrNO |
| Molecular Weight | 318.21 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 8-bromo-5-methoxy-3-phenyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | COc1ccc(Br)c2c1CC(c1ccccc1)NC2 |
| InChI | InChI=1S/C16H16BrNO/c1-19-16-8-7-14(17)13-10-18-15(9-12(13)16)11-5-3-2-4-6-11/h2-8,15,18H,9-10H2,1H3 |
| InChIKey | UODKWQUAODKAPE-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.21 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |