About carbon monoxide;iron;triphenylphosphanium
carbon monoxide;iron;triphenylphosphanium (PubChem CID 6327270) has the molecular formula C22H16FeO4P+
and a molecular weight of 431.19 g/mol. Its IUPAC name is carbon monoxide;iron;triphenylphosphanium.
Molecular Properties
| Compound Name | carbon monoxide;iron;triphenylphosphanium |
| PubChem CID | 6327270 |
| Molecular Formula | C22H16FeO4P+ |
| Molecular Weight | 431.19 g/mol |
| Exact Mass | 431.01 |
| IUPAC Name | carbon monoxide;iron;triphenylphosphanium |
| SMILES | [C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[Fe].c1ccc([PH+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.4CO.Fe/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;4*1-2;/h1-15H;;;;;/p+1 |
| InChIKey | GHXDZMLBRWBQAM-UHFFFAOYSA-O |
| XLogP | 3.02 |
| TPSA | 79.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.19 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze carbon monoxide;iron;triphenylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon monoxide;iron;triphenylphosphanium?
The IUPAC name of carbon monoxide;iron;triphenylphosphanium (CID 6327270) is carbon monoxide;iron;triphenylphosphanium.
What is the SMILES notation for carbon monoxide;iron;triphenylphosphanium?
The canonical SMILES for carbon monoxide;iron;triphenylphosphanium is [C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[Fe].c1ccc([PH+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of carbon monoxide;iron;triphenylphosphanium?
The InChIKey is GHXDZMLBRWBQAM-UHFFFAOYSA-O. The full InChI is InChI=1S/C18H15P.4CO.Fe/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;4*1-2;/h1-15H;;;;;/p+1.
What are the key properties of carbon monoxide;iron;triphenylphosphanium?
carbon monoxide;iron;triphenylphosphanium has a molecular weight of 431.19 g/mol, XLogP of 3.02, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;iron;triphenylphosphanium is sourced from PubChem (CID 6327270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).