About 1,1,3,3-Tetramethyldisilazane
1,1,3,3-Tetramethyldisilazane (PubChem CID 6327317) has the molecular formula C4H13NSi2
and a molecular weight of 131.33 g/mol.
Molecular Properties
| Compound Name | 1,1,3,3-Tetramethyldisilazane |
| PubChem CID | 6327317 |
| Molecular Formula | C4H13NSi2 |
| Molecular Weight | 131.33 g/mol |
| Exact Mass | 131.06 |
| IUPAC Name | — |
| SMILES | C[Si](C)N[Si](C)C |
| InChI | InChI=1S/C4H13NSi2/c1-6(2)5-7(3)4/h5H,1-4H3 |
| InChIKey | GJWAPAVRQYYSTK-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.33 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,1,3,3-Tetramethyldisilazane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,3,3-Tetramethyldisilazane?
The IUPAC name of 1,1,3,3-Tetramethyldisilazane (CID 6327317) is not available.
What is the SMILES notation for 1,1,3,3-Tetramethyldisilazane?
The canonical SMILES for 1,1,3,3-Tetramethyldisilazane is C[Si](C)N[Si](C)C.
What is the InChIKey of 1,1,3,3-Tetramethyldisilazane?
The InChIKey is GJWAPAVRQYYSTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H13NSi2/c1-6(2)5-7(3)4/h5H,1-4H3.
What are the key properties of 1,1,3,3-Tetramethyldisilazane?
1,1,3,3-Tetramethyldisilazane has a molecular weight of 131.33 g/mol, XLogP of 1.08, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,3,3-Tetramethyldisilazane is sourced from PubChem (CID 6327317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).