C8H24O3Si4 — CID 6327318
Tetrasiloxane, 1,1,1,3,5,7,7,7-octamethyl- (PubChem CID 6327318) has the molecular formula C8H24O3Si4 and a molecular weight of 280.62 g/mol.
| Compound Name | Tetrasiloxane, 1,1,1,3,5,7,7,7-octamethyl- |
|---|---|
| PubChem CID | 6327318 |
| Molecular Formula | C8H24O3Si4 |
| Molecular Weight | 280.62 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | — |
| SMILES | C[Si](O[Si](C)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C8H24O3Si4/c1-12(10-14(3,4)5)9-13(2)11-15(6,7)8/h1-8H3 |
| InChIKey | OHSYWAVRSCQMHG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.62 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|