C9H27Si4 — CID 6327365
1,1,1,3,3,3-Hexamethyl-2-trimethylsilyl-trisilane (PubChem CID 6327365) has the molecular formula C9H27Si4 and a molecular weight of 247.66 g/mol.
| Compound Name | 1,1,1,3,3,3-Hexamethyl-2-trimethylsilyl-trisilane |
|---|---|
| PubChem CID | 6327365 |
| Molecular Formula | C9H27Si4 |
| Molecular Weight | 247.66 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | — |
| SMILES | C[Si](C)(C)[Si]([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C9H27Si4/c1-11(2,3)10(12(4,5)6)13(7,8)9/h1-9H3 |
| InChIKey | SCHZCUMIENIQMY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.66 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|