C17H28N2O — CID 63273656
2-[methyl-[(1-methylpyrrolidin-3-yl)methyl]amino]-1-phenylbutan-1-ol (PubChem CID 63273656) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is 2-[methyl-[(1-methylpyrrolidin-3-yl)methyl]amino]-1-phenylbutan-1-ol.
| Compound Name | 2-[methyl-[(1-methylpyrrolidin-3-yl)methyl]amino]-1-phenylbutan-1-ol |
|---|---|
| PubChem CID | 63273656 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | 2-[methyl-[(1-methylpyrrolidin-3-yl)methyl]amino]-1-phenylbutan-1-ol |
| SMILES | CCC(C(O)c1ccccc1)N(C)CC1CCN(C)C1 |
| InChI | InChI=1S/C17H28N2O/c1-4-16(17(20)15-8-6-5-7-9-15)19(3)13-14-10-11-18(2)12-14/h5-9,14,16-17,20H,4,10-13H2,1-3H3 |
| InChIKey | FLUJEAHBDVTLQY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |