About Silane, DI-2-furanylmethyl-
Silane, DI-2-furanylmethyl- (PubChem CID 6327371) has the molecular formula C9H9O2Si
and a molecular weight of 177.25 g/mol.
Molecular Properties
| Compound Name | Silane, DI-2-furanylmethyl- |
| PubChem CID | 6327371 |
| Molecular Formula | C9H9O2Si |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | — |
| SMILES | C[Si](c1ccco1)c1ccco1 |
| InChI | InChI=1S/C9H9O2Si/c1-12(8-4-2-6-10-8)9-5-3-7-11-9/h2-7H,1H3 |
| InChIKey | VTAIQHITNRQVNL-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Silane, DI-2-furanylmethyl- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Silane, DI-2-furanylmethyl-?
The IUPAC name of Silane, DI-2-furanylmethyl- (CID 6327371) is not available.
What is the SMILES notation for Silane, DI-2-furanylmethyl-?
The canonical SMILES for Silane, DI-2-furanylmethyl- is C[Si](c1ccco1)c1ccco1.
What is the InChIKey of Silane, DI-2-furanylmethyl-?
The InChIKey is VTAIQHITNRQVNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9O2Si/c1-12(8-4-2-6-10-8)9-5-3-7-11-9/h2-7H,1H3.
What are the key properties of Silane, DI-2-furanylmethyl-?
Silane, DI-2-furanylmethyl- has a molecular weight of 177.25 g/mol, XLogP of 1.11, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Silane, DI-2-furanylmethyl- is sourced from PubChem (CID 6327371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).