C11H22N4 — CID 63273995
2-amino-4-[methyl-[(1-methylpyrrolidin-3-yl)methyl]amino]butanenitrile (PubChem CID 63273995) has the molecular formula C11H22N4 and a molecular weight of 210.32 g/mol. Its IUPAC name is 2-amino-4-[methyl-[(1-methylpyrrolidin-3-yl)methyl]amino]butanenitrile.
| Compound Name | 2-amino-4-[methyl-[(1-methylpyrrolidin-3-yl)methyl]amino]butanenitrile |
|---|---|
| PubChem CID | 63273995 |
| Molecular Formula | C11H22N4 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.18 |
| IUPAC Name | 2-amino-4-[methyl-[(1-methylpyrrolidin-3-yl)methyl]amino]butanenitrile |
| SMILES | CN(CCC(N)C#N)CC1CCN(C)C1 |
| InChI | InChI=1S/C11H22N4/c1-14-5-3-10(8-14)9-15(2)6-4-11(13)7-12/h10-11H,3-6,8-9,13H2,1-2H3 |
| InChIKey | FWIOZOSRGGLLRE-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 56.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |