C15H31N3 — CID 63274170
N-[(3-ethylpiperidin-3-yl)methyl]-N-methyl-1-(1-methylpyrrolidin-3-yl)methanamine (PubChem CID 63274170) has the molecular formula C15H31N3 and a molecular weight of 253.43 g/mol. Its IUPAC name is N-[(3-ethylpiperidin-3-yl)methyl]-N-methyl-1-(1-methylpyrrolidin-3-yl)methanamine.
| Compound Name | N-[(3-ethylpiperidin-3-yl)methyl]-N-methyl-1-(1-methylpyrrolidin-3-yl)methanamine |
|---|---|
| PubChem CID | 63274170 |
| Molecular Formula | C15H31N3 |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.25 |
| IUPAC Name | N-[(3-ethylpiperidin-3-yl)methyl]-N-methyl-1-(1-methylpyrrolidin-3-yl)methanamine |
| SMILES | CCC1(CN(C)CC2CCN(C)C2)CCCNC1 |
| InChI | InChI=1S/C15H31N3/c1-4-15(7-5-8-16-12-15)13-18(3)11-14-6-9-17(2)10-14/h14,16H,4-13H2,1-3H3 |
| InChIKey | CTPCKGNRHWNJQU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |