About Benzcatechinborane
Benzcatechinborane (PubChem CID 6327445) has the molecular formula C6H4BO2
and a molecular weight of 118.91 g/mol.
Molecular Properties
| Compound Name | Benzcatechinborane |
| PubChem CID | 6327445 |
| Molecular Formula | C6H4BO2 |
| Molecular Weight | 118.91 g/mol |
| Exact Mass | 119.03 |
| IUPAC Name | — |
| SMILES | [B]1Oc2ccccc2O1 |
| InChI | InChI=1S/C6H4BO2/c1-2-4-6-5(3-1)8-7-9-6/h1-4H |
| InChIKey | ZDQWVKDDJDIVAL-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.91 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Benzcatechinborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Benzcatechinborane?
The IUPAC name of Benzcatechinborane (CID 6327445) is not available.
What is the SMILES notation for Benzcatechinborane?
The canonical SMILES for Benzcatechinborane is [B]1Oc2ccccc2O1.
What is the InChIKey of Benzcatechinborane?
The InChIKey is ZDQWVKDDJDIVAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BO2/c1-2-4-6-5(3-1)8-7-9-6/h1-4H.
What are the key properties of Benzcatechinborane?
Benzcatechinborane has a molecular weight of 118.91 g/mol, XLogP of 0.99, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Benzcatechinborane is sourced from PubChem (CID 6327445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).