About Trihexylsilane
Trihexylsilane (PubChem CID 6327464) has the molecular formula C18H39Si
and a molecular weight of 283.60 g/mol.
Molecular Properties
| Compound Name | Trihexylsilane |
| PubChem CID | 6327464 |
| Molecular Formula | C18H39Si |
| Molecular Weight | 283.60 g/mol |
| Exact Mass | 283.28 |
| IUPAC Name | — |
| SMILES | CCCCCC[Si](CCCCCC)CCCCCC |
| InChI | InChI=1S/C18H39Si/c1-4-7-10-13-16-19(17-14-11-8-5-2)18-15-12-9-6-3/h4-18H2,1-3H3 |
| InChIKey | ISPSHPOFLYFIRR-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 283.60 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Trihexylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Trihexylsilane?
The IUPAC name of Trihexylsilane (CID 6327464) is not available.
What is the SMILES notation for Trihexylsilane?
The canonical SMILES for Trihexylsilane is CCCCCC[Si](CCCCCC)CCCCCC.
What is the InChIKey of Trihexylsilane?
The InChIKey is ISPSHPOFLYFIRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H39Si/c1-4-7-10-13-16-19(17-14-11-8-5-2)18-15-12-9-6-3/h4-18H2,1-3H3.
What are the key properties of Trihexylsilane?
Trihexylsilane has a molecular weight of 283.60 g/mol, XLogP of 7.22, 15 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Trihexylsilane is sourced from PubChem (CID 6327464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).