C15H22N2O3S — CID 63274742
3-acetyl-N-methyl-N-[(1-methylpyrrolidin-3-yl)methyl]benzenesulfonamide (PubChem CID 63274742) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is 3-acetyl-N-methyl-N-[(1-methylpyrrolidin-3-yl)methyl]benzenesulfonamide.
| Compound Name | 3-acetyl-N-methyl-N-[(1-methylpyrrolidin-3-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 63274742 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 3-acetyl-N-methyl-N-[(1-methylpyrrolidin-3-yl)methyl]benzenesulfonamide |
| SMILES | CC(=O)c1cccc(S(=O)(=O)N(C)CC2CCN(C)C2)c1 |
| InChI | InChI=1S/C15H22N2O3S/c1-12(18)14-5-4-6-15(9-14)21(19,20)17(3)11-13-7-8-16(2)10-13/h4-6,9,13H,7-8,10-11H2,1-3H3 |
| InChIKey | GUQXWBNRQOUUIV-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |