About 1,1,3,3-Tetramethyldisiloxane
1,1,3,3-Tetramethyldisiloxane (PubChem CID 6327482) has the molecular formula C4H12OSi2
and a molecular weight of 132.31 g/mol.
Molecular Properties
| Compound Name | 1,1,3,3-Tetramethyldisiloxane |
| PubChem CID | 6327482 |
| Molecular Formula | C4H12OSi2 |
| Molecular Weight | 132.31 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | — |
| SMILES | C[Si](C)O[Si](C)C |
| InChI | InChI=1S/C4H12OSi2/c1-6(2)5-7(3)4/h1-4H3 |
| InChIKey | KWEKXPWNFQBJAY-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,1,3,3-Tetramethyldisiloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,3,3-Tetramethyldisiloxane?
The IUPAC name of 1,1,3,3-Tetramethyldisiloxane (CID 6327482) is not available.
What is the SMILES notation for 1,1,3,3-Tetramethyldisiloxane?
The canonical SMILES for 1,1,3,3-Tetramethyldisiloxane is C[Si](C)O[Si](C)C.
What is the InChIKey of 1,1,3,3-Tetramethyldisiloxane?
The InChIKey is KWEKXPWNFQBJAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12OSi2/c1-6(2)5-7(3)4/h1-4H3.
What are the key properties of 1,1,3,3-Tetramethyldisiloxane?
1,1,3,3-Tetramethyldisiloxane has a molecular weight of 132.31 g/mol, XLogP of 1.51, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,3,3-Tetramethyldisiloxane is sourced from PubChem (CID 6327482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).