C10H18ClN3O2 — CID 63275498
2-chloro-N-[methyl-[(1-methylpyrrolidin-3-yl)methyl]carbamoyl]acetamide (PubChem CID 63275498) has the molecular formula C10H18ClN3O2 and a molecular weight of 247.73 g/mol. Its IUPAC name is 2-chloro-N-[methyl-[(1-methylpyrrolidin-3-yl)methyl]carbamoyl]acetamide.
| Compound Name | 2-chloro-N-[methyl-[(1-methylpyrrolidin-3-yl)methyl]carbamoyl]acetamide |
|---|---|
| PubChem CID | 63275498 |
| Molecular Formula | C10H18ClN3O2 |
| Molecular Weight | 247.73 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 2-chloro-N-[methyl-[(1-methylpyrrolidin-3-yl)methyl]carbamoyl]acetamide |
| SMILES | CN1CCC(CN(C)C(=O)NC(=O)CCl)C1 |
| InChI | InChI=1S/C10H18ClN3O2/c1-13-4-3-8(6-13)7-14(2)10(16)12-9(15)5-11/h8H,3-7H2,1-2H3,(H,12,15,16) |
| InChIKey | QLTVLJOGHVJKBA-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.73 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|