About Triisopropylsilane
Triisopropylsilane (PubChem CID 6327611) has the molecular formula C9H21Si
and a molecular weight of 157.35 g/mol.
Molecular Properties
| Compound Name | Triisopropylsilane |
|---|
| PubChem CID | 6327611 |
|---|
| Molecular Formula | C9H21Si |
|---|
| Molecular Weight | 157.35 g/mol |
|---|
| Exact Mass | 157.14 |
|---|
| IUPAC Name | — |
|---|
| SMILES | CC(C)[Si](C(C)C)C(C)C |
|---|
| InChI | InChI=1S/C9H21Si/c1-7(2)10(8(3)4)9(5)6/h7-9H,1-6H3 |
|---|
| InChIKey | ZGYICYBLPGRURT-UHFFFAOYSA-N |
|---|
| XLogP | 3.71 |
|---|
| TPSA | 0.00 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | |
|---|
| Rotatable Bonds | 3 |
|---|
| Heavy Atoms | 10 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 157.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Triisopropylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Triisopropylsilane?
The IUPAC name of Triisopropylsilane (CID 6327611) is not available.
What is the SMILES notation for Triisopropylsilane?
The canonical SMILES for Triisopropylsilane is CC(C)[Si](C(C)C)C(C)C.
What is the InChIKey of Triisopropylsilane?
The InChIKey is ZGYICYBLPGRURT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21Si/c1-7(2)10(8(3)4)9(5)6/h7-9H,1-6H3.
What are the key properties of Triisopropylsilane?
Triisopropylsilane has a molecular weight of 157.35 g/mol, XLogP of 3.71, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Triisopropylsilane is sourced from PubChem (CID 6327611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).