About diethoxy(oxo)phosphanium
diethoxy(oxo)phosphanium (PubChem CID 6327654) has the molecular formula C4H10O3P+
and a molecular weight of 137.09 g/mol. Its IUPAC name is diethoxy(oxo)phosphanium.
Molecular Properties
| Compound Name | diethoxy(oxo)phosphanium |
| PubChem CID | 6327654 |
| Molecular Formula | C4H10O3P+ |
| Molecular Weight | 137.09 g/mol |
| Exact Mass | 137.04 |
| IUPAC Name | diethoxy(oxo)phosphanium |
| SMILES | CCO[P+](=O)OCC |
| InChI | InChI=1S/C4H10O3P/c1-3-6-8(5)7-4-2/h3-4H2,1-2H3/q+1 |
| InChIKey | LXCYSACZTOKNNS-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.09 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diethoxy(oxo)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethoxy(oxo)phosphanium?
The IUPAC name of diethoxy(oxo)phosphanium (CID 6327654) is diethoxy(oxo)phosphanium.
What is the SMILES notation for diethoxy(oxo)phosphanium?
The canonical SMILES for diethoxy(oxo)phosphanium is CCO[P+](=O)OCC.
What is the InChIKey of diethoxy(oxo)phosphanium?
The InChIKey is LXCYSACZTOKNNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O3P/c1-3-6-8(5)7-4-2/h3-4H2,1-2H3/q+1.
What are the key properties of diethoxy(oxo)phosphanium?
diethoxy(oxo)phosphanium has a molecular weight of 137.09 g/mol, XLogP of 1.72, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxy(oxo)phosphanium is sourced from PubChem (CID 6327654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).