About Phenyldimethylsilane
Phenyldimethylsilane (PubChem CID 6327656) has the molecular formula C8H11Si
and a molecular weight of 135.26 g/mol.
Molecular Properties
| Compound Name | Phenyldimethylsilane |
| PubChem CID | 6327656 |
| Molecular Formula | C8H11Si |
| Molecular Weight | 135.26 g/mol |
| Exact Mass | 135.06 |
| IUPAC Name | — |
| SMILES | C[Si](C)c1ccccc1 |
| InChI | InChI=1S/C8H11Si/c1-9(2)8-6-4-3-5-7-8/h3-7H,1-2H3 |
| InChIKey | OIKHZBFJHONJJB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Phenyldimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Phenyldimethylsilane?
The IUPAC name of Phenyldimethylsilane (CID 6327656) is not available.
What is the SMILES notation for Phenyldimethylsilane?
The canonical SMILES for Phenyldimethylsilane is C[Si](C)c1ccccc1.
What is the InChIKey of Phenyldimethylsilane?
The InChIKey is OIKHZBFJHONJJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11Si/c1-9(2)8-6-4-3-5-7-8/h3-7H,1-2H3.
What are the key properties of Phenyldimethylsilane?
Phenyldimethylsilane has a molecular weight of 135.26 g/mol, XLogP of 1.65, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Phenyldimethylsilane is sourced from PubChem (CID 6327656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).