About Triphenyltin oxide
Triphenyltin oxide (PubChem CID 6327657) has the molecular formula C18H17OSn
and a molecular weight of 368.04 g/mol.
Molecular Properties
| Compound Name | Triphenyltin oxide |
| PubChem CID | 6327657 |
| Molecular Formula | C18H17OSn |
| Molecular Weight | 368.04 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | — |
| SMILES | O.c1ccc([Sn](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/3C6H5.H2O.Sn/c3*1-2-4-6-5-3-1;;/h3*1-5H;1H2; |
| InChIKey | NRHFWOJROOQKBK-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.04 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze Triphenyltin oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Triphenyltin oxide?
The IUPAC name of Triphenyltin oxide (CID 6327657) is not available.
What is the SMILES notation for Triphenyltin oxide?
The canonical SMILES for Triphenyltin oxide is O.c1ccc([Sn](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of Triphenyltin oxide?
The InChIKey is NRHFWOJROOQKBK-UHFFFAOYSA-N. The full InChI is InChI=1S/3C6H5.H2O.Sn/c3*1-2-4-6-5-3-1;;/h3*1-5H;1H2;.
What are the key properties of Triphenyltin oxide?
Triphenyltin oxide has a molecular weight of 368.04 g/mol, XLogP of 1.38, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Triphenyltin oxide is sourced from PubChem (CID 6327657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).