C11H12BrN3 — CID 63276707
1-[(2-bromophenyl)methyl]-4-methylpyrazol-3-amine (PubChem CID 63276707) has the molecular formula C11H12BrN3 and a molecular weight of 266.14 g/mol. Its IUPAC name is 1-[(2-bromophenyl)methyl]-4-methylpyrazol-3-amine.
| Compound Name | 1-[(2-bromophenyl)methyl]-4-methylpyrazol-3-amine |
|---|---|
| PubChem CID | 63276707 |
| Molecular Formula | C11H12BrN3 |
| Molecular Weight | 266.14 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | 1-[(2-bromophenyl)methyl]-4-methylpyrazol-3-amine |
| SMILES | Cc1cn(Cc2ccccc2Br)nc1N |
| InChI | InChI=1S/C11H12BrN3/c1-8-6-15(14-11(8)13)7-9-4-2-3-5-10(9)12/h2-6H,7H2,1H3,(H2,13,14) |
| InChIKey | RUNFLKQFJVQCMF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.14 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |